C16H24N4O3 — CID 125443774
(5R)-5-[2-[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-2-oxoethyl]-3-propylimidazolidine-2,4-dione (PubChem CID 125443774) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (5R)-5-[2-[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-2-oxoethyl]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-2-oxoethyl]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125443774 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (5R)-5-[2-[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-2-oxoethyl]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N[C@H](CC(=O)N2[C@@H]3CC[C@H]2[C@H]2CNC[C@H]23)C1=O |
| InChI | InChI=1S/C16H24N4O3/c1-2-5-19-15(22)11(18-16(19)23)6-14(21)20-12-3-4-13(20)10-8-17-7-9(10)12/h9-13,17H,2-8H2,1H3,(H,18,23)/t9-,10+,11-,12-,13+/m1/s1 |
| InChIKey | RNVRNTBFKSWBEQ-MLGHIDQZSA-N |
| XLogP | -0.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|