C16H10Br2Cl2O2 — CID 12544461
2,3-dibromo-1,4-bis(4-chlorophenyl)butane-1,4-dione (PubChem CID 12544461) has the molecular formula C16H10Br2Cl2O2 and a molecular weight of 464.97 g/mol. Its IUPAC name is 2,3-dibromo-1,4-bis(4-chlorophenyl)butane-1,4-dione.
| Compound Name | 2,3-dibromo-1,4-bis(4-chlorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 12544461 |
| Molecular Formula | C16H10Br2Cl2O2 |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 461.84 |
| IUPAC Name | 2,3-dibromo-1,4-bis(4-chlorophenyl)butane-1,4-dione |
| SMILES | O=C(c1ccc(Cl)cc1)C(Br)C(Br)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10Br2Cl2O2/c17-13(15(21)9-1-5-11(19)6-2-9)14(18)16(22)10-3-7-12(20)8-4-10/h1-8,13-14H |
| InChIKey | XJQGKEJSMHLKCV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|