C18H27N3O — CID 125444826
N-[(1R)-1-pyridin-2-ylpropyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide (PubChem CID 125444826) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[(1R)-1-pyridin-2-ylpropyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide.
| Compound Name | N-[(1R)-1-pyridin-2-ylpropyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 125444826 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[(1R)-1-pyridin-2-ylpropyl]-1-pyrrolidin-1-ylcyclopentane-1-carboxamide |
| SMILES | CC[C@@H](NC(=O)C1(N2CCCC2)CCCC1)c1ccccn1 |
| InChI | InChI=1S/C18H27N3O/c1-2-15(16-9-3-6-12-19-16)20-17(22)18(10-4-5-11-18)21-13-7-8-14-21/h3,6,9,12,15H,2,4-5,7-8,10-11,13-14H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | RQWFTYILWVLCOI-OAHLLOKOSA-N |
| XLogP | 3.06 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |