C17H25N5O2 — CID 125446393
1-(2-methoxyethyl)-3-[(1S)-1-(2-methylpyrazol-3-yl)propyl]-1-(pyridin-2-ylmethyl)urea (PubChem CID 125446393) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(1S)-1-(2-methylpyrazol-3-yl)propyl]-1-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-(2-methoxyethyl)-3-[(1S)-1-(2-methylpyrazol-3-yl)propyl]-1-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 125446393 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(1S)-1-(2-methylpyrazol-3-yl)propyl]-1-(pyridin-2-ylmethyl)urea |
| SMILES | CC[C@H](NC(=O)N(CCOC)Cc1ccccn1)c1ccnn1C |
| InChI | InChI=1S/C17H25N5O2/c1-4-15(16-8-10-19-21(16)2)20-17(23)22(11-12-24-3)13-14-7-5-6-9-18-14/h5-10,15H,4,11-13H2,1-3H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | NMKIGAULVVGUPS-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |