About 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea
3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea (PubChem CID 125446420) has the molecular formula C19H28N4O2
and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea.
Molecular Properties
| Compound Name | 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea |
| PubChem CID | 125446420 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea |
| SMILES | COCC(C)(C)CNC(=O)N(C)[C@@H](C)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H28N4O2/c1-14(23(4)18(24)20-12-19(2,3)13-25-5)16-11-17(22-21-16)15-9-7-6-8-10-15/h6-11,14H,12-13H2,1-5H3,(H,20,24)(H,21,22)/t14-/m0/s1 |
| InChIKey | OMHUDHOZWYOTOM-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea?
The IUPAC name of 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea (CID 125446420) is 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea.
What is the SMILES notation for 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea?
The canonical SMILES for 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea is COCC(C)(C)CNC(=O)N(C)[C@@H](C)c1cc(-c2ccccc2)n[nH]1.
What is the InChIKey of 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea?
The InChIKey is OMHUDHOZWYOTOM-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H28N4O2/c1-14(23(4)18(24)20-12-19(2,3)13-25-5)16-11-17(22-21-16)15-9-7-6-8-10-15/h6-11,14H,12-13H2,1-5H3,(H,20,24)(H,21,22)/t14-/m0/s1.
What are the key properties of 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea?
3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea has a molecular weight of 344.46 g/mol, XLogP of 3.45, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxy-2,2-dimethylpropyl)-1-methyl-1-[(1S)-1-(3-phenyl-1H-pyrazol-5-yl)ethyl]urea is sourced from PubChem (CID 125446420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).