C23H26N4O — CID 125446676
4-(3-aminoisoquinolin-6-yl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]benzamide (PubChem CID 125446676) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-(3-aminoisoquinolin-6-yl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]benzamide.
| Compound Name | 4-(3-aminoisoquinolin-6-yl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 125446676 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-(3-aminoisoquinolin-6-yl)-N-[2-[(2R)-1-methylpyrrolidin-2-yl]ethyl]benzamide |
| SMILES | CN1CCC[C@@H]1CCNC(=O)c1ccc(-c2ccc3cnc(N)cc3c2)cc1 |
| InChI | InChI=1S/C23H26N4O/c1-27-12-2-3-21(27)10-11-25-23(28)17-6-4-16(5-7-17)18-8-9-19-15-26-22(24)14-20(19)13-18/h4-9,13-15,21H,2-3,10-12H2,1H3,(H2,24,26)(H,25,28)/t21-/m1/s1 |
| InChIKey | APVDXEDOIFERGV-OAQYLSRUSA-N |
| XLogP | 3.70 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |