About 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine
6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine (PubChem CID 125446780) has the molecular formula C13H25N5
and a molecular weight of 251.38 g/mol. Its IUPAC name is 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine |
| PubChem CID | 125446780 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine |
| SMILES | CCC[C@@H](CNc1cncc(N(C)C)n1)N(C)C |
| InChI | InChI=1S/C13H25N5/c1-6-7-11(17(2)3)8-15-12-9-14-10-13(16-12)18(4)5/h9-11H,6-8H2,1-5H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | UDNDJLQNHIVVHO-NSHDSACASA-N |
| XLogP | 1.68 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine?
The IUPAC name of 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine (CID 125446780) is 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine.
What is the SMILES notation for 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine?
The canonical SMILES for 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine is CCC[C@@H](CNc1cncc(N(C)C)n1)N(C)C.
What is the InChIKey of 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine?
The InChIKey is UDNDJLQNHIVVHO-NSHDSACASA-N. The full InChI is InChI=1S/C13H25N5/c1-6-7-11(17(2)3)8-15-12-9-14-10-13(16-12)18(4)5/h9-11H,6-8H2,1-5H3,(H,15,16)/t11-/m0/s1.
What are the key properties of 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine?
6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine has a molecular weight of 251.38 g/mol, XLogP of 1.68, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-[(2S)-2-(dimethylamino)pentyl]-2-N,2-N-dimethylpyrazine-2,6-diamine is sourced from PubChem (CID 125446780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).