2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid

C6H8Br2O2 — CID 12544679

IUPAC2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid
SMILESO=C(O)C1CC1C(Br)CBr
InChIInChI=1S/C6H8Br2O2/c7-2-5(8)3-1-4(3)6(9)10/h3-5H,1-2H2,(H,9,10)
InChIKeySODWROHEHOCKKG-UHFFFAOYSA-N
MW271.94 g/mol
LogP1.87
Rot. Bonds3

About 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid

2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid (PubChem CID 12544679) has the molecular formula C6H8Br2O2 and a molecular weight of 271.94 g/mol. Its IUPAC name is 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid
PubChem CID12544679
Molecular FormulaC6H8Br2O2
Molecular Weight271.94 g/mol
Exact Mass269.89
IUPAC Name2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid
SMILESO=C(O)C1CC1C(Br)CBr
InChIInChI=1S/C6H8Br2O2/c7-2-5(8)3-1-4(3)6(9)10/h3-5H,1-2H2,(H,9,10)
InChIKeySODWROHEHOCKKG-UHFFFAOYSA-N
XLogP1.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.94
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid?
The IUPAC name of 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid (CID 12544679) is 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid is O=C(O)C1CC1C(Br)CBr.
What is the InChIKey of 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid?
The InChIKey is SODWROHEHOCKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Br2O2/c7-2-5(8)3-1-4(3)6(9)10/h3-5H,1-2H2,(H,9,10).
What are the key properties of 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid?
2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid has a molecular weight of 271.94 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dibromoethyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 12544679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).