About N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide
N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide (PubChem CID 125446825) has the molecular formula C19H22N6O
and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide |
| PubChem CID | 125446825 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide |
| SMILES | CNc1nccnc1-c1ccc(C(=O)N[C@H](C)c2c(C)n[nH]c2C)cc1 |
| InChI | InChI=1S/C19H22N6O/c1-11(16-12(2)24-25-13(16)3)23-19(26)15-7-5-14(6-8-15)17-18(20-4)22-10-9-21-17/h5-11H,1-4H3,(H,20,22)(H,23,26)(H,24,25)/t11-/m1/s1 |
| InChIKey | XUUAIQGRRBITAA-LLVKDONJSA-N |
| XLogP | 3.02 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide?
The IUPAC name of N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide (CID 125446825) is N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide.
What is the SMILES notation for N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide?
The canonical SMILES for N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide is CNc1nccnc1-c1ccc(C(=O)N[C@H](C)c2c(C)n[nH]c2C)cc1.
What is the InChIKey of N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide?
The InChIKey is XUUAIQGRRBITAA-LLVKDONJSA-N. The full InChI is InChI=1S/C19H22N6O/c1-11(16-12(2)24-25-13(16)3)23-19(26)15-7-5-14(6-8-15)17-18(20-4)22-10-9-21-17/h5-11H,1-4H3,(H,20,22)(H,23,26)(H,24,25)/t11-/m1/s1.
What are the key properties of N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide?
N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide has a molecular weight of 350.43 g/mol, XLogP of 3.02, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-[3-(methylamino)pyrazin-2-yl]benzamide is sourced from PubChem (CID 125446825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).