C16H20N4O — CID 125447530
(E)-N-[(1R)-1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-3-phenylprop-2-enamide (PubChem CID 125447530) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 125447530 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (E)-N-[(1R)-1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-3-phenylprop-2-enamide |
| SMILES | CC[C@@H](NC(=O)/C=C/c1ccccc1)c1ncnn1CC |
| InChI | InChI=1S/C16H20N4O/c1-3-14(16-17-12-18-20(16)4-2)19-15(21)11-10-13-8-6-5-7-9-13/h5-12,14H,3-4H2,1-2H3,(H,19,21)/b11-10+/t14-/m1/s1 |
| InChIKey | ALRCWRHCXHVDIW-PLSXKVAHSA-N |
| XLogP | 2.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|