About (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one
(2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one (PubChem CID 125447708) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one.
Molecular Properties
| Compound Name | (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one |
| PubChem CID | 125447708 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one |
| SMILES | CC[C@H](C(=O)N1C[C@H]2CC[C@@H](C1)C2N)n1cccn1 |
| InChI | InChI=1S/C14H22N4O/c1-2-12(18-7-3-6-16-18)14(19)17-8-10-4-5-11(9-17)13(10)15/h3,6-7,10-13H,2,4-5,8-9,15H2,1H3/t10-,11+,12-,13?/m1/s1 |
| InChIKey | JZPQIMFJEGUUQG-DAAZQVBGSA-N |
| XLogP | 1.03 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one?
The IUPAC name of (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one (CID 125447708) is (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one.
What is the SMILES notation for (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one?
The canonical SMILES for (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one is CC[C@H](C(=O)N1C[C@H]2CC[C@@H](C1)C2N)n1cccn1.
What is the InChIKey of (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one?
The InChIKey is JZPQIMFJEGUUQG-DAAZQVBGSA-N. The full InChI is InChI=1S/C14H22N4O/c1-2-12(18-7-3-6-16-18)14(19)17-8-10-4-5-11(9-17)13(10)15/h3,6-7,10-13H,2,4-5,8-9,15H2,1H3/t10-,11+,12-,13?/m1/s1.
What are the key properties of (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one?
(2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one has a molecular weight of 262.36 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(1S,5R)-8-amino-3-azabicyclo[3.2.1]octan-3-yl]-2-pyrazol-1-ylbutan-1-one is sourced from PubChem (CID 125447708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).