About N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine
N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine (PubChem CID 125447897) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine.
Molecular Properties
| Compound Name | N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine |
| PubChem CID | 125447897 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine |
| SMILES | CC(C)c1ccc(NC[C@H]2CC2(C)C)nn1 |
| InChI | InChI=1S/C13H21N3/c1-9(2)11-5-6-12(16-15-11)14-8-10-7-13(10,3)4/h5-6,9-10H,7-8H2,1-4H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | UOVDRGVXUBHAJG-SNVBAGLBSA-N |
| XLogP | 3.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine?
The IUPAC name of N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine (CID 125447897) is N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine.
What is the SMILES notation for N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine?
The canonical SMILES for N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine is CC(C)c1ccc(NC[C@H]2CC2(C)C)nn1.
What is the InChIKey of N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine?
The InChIKey is UOVDRGVXUBHAJG-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H21N3/c1-9(2)11-5-6-12(16-15-11)14-8-10-7-13(10,3)4/h5-6,9-10H,7-8H2,1-4H3,(H,14,16)/t10-/m1/s1.
What are the key properties of N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine?
N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine has a molecular weight of 219.33 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1S)-2,2-dimethylcyclopropyl]methyl]-6-propan-2-ylpyridazin-3-amine is sourced from PubChem (CID 125447897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).