C13H23N5O2 — CID 125448282
N-[2-[[(1R)-2-methyl-1-(1-methylimidazol-2-yl)propyl]carbamoylamino]ethyl]acetamide (PubChem CID 125448282) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[2-[[(1R)-2-methyl-1-(1-methylimidazol-2-yl)propyl]carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[[(1R)-2-methyl-1-(1-methylimidazol-2-yl)propyl]carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 125448282 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-[2-[[(1R)-2-methyl-1-(1-methylimidazol-2-yl)propyl]carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)N[C@@H](c1nccn1C)C(C)C |
| InChI | InChI=1S/C13H23N5O2/c1-9(2)11(12-15-7-8-18(12)4)17-13(20)16-6-5-14-10(3)19/h7-9,11H,5-6H2,1-4H3,(H,14,19)(H2,16,17,20)/t11-/m1/s1 |
| InChIKey | VGZWWRKXJYZXJB-LLVKDONJSA-N |
| XLogP | 0.55 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|