C15H18ClFN2O — CID 125448381
(2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 125448381) has the molecular formula C15H18ClFN2O and a molecular weight of 296.77 g/mol. Its IUPAC name is (2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | (2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 125448381 |
| Molecular Formula | C15H18ClFN2O |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-propan-2-yl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CC(C)[C@@H]1C=CCN1C(=O)NCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H18ClFN2O/c1-10(2)14-4-3-7-19(14)15(20)18-9-11-5-6-12(17)8-13(11)16/h3-6,8,10,14H,7,9H2,1-2H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | UJWLSALSJFLXOL-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|