C15H20N8OS — CID 125448429
2-methyl-5-[[4-methyl-5-[(3S)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 125448429) has the molecular formula C15H20N8OS and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-methyl-5-[[4-methyl-5-[(3S)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-methyl-5-[[4-methyl-5-[(3S)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 125448429 |
| Molecular Formula | C15H20N8OS |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-methyl-5-[[4-methyl-5-[(3S)-piperidin-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2nc(CSc3nnc([C@H]4CCCNC4)n3C)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C15H20N8OS/c1-9-17-14-18-11(6-12(24)23(14)21-9)8-25-15-20-19-13(22(15)2)10-4-3-5-16-7-10/h6,10,16H,3-5,7-8H2,1-2H3,(H,17,18,21)/t10-/m0/s1 |
| InChIKey | JBTYIZAQCCUHLT-JTQLQIEISA-N |
| XLogP | 0.61 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |