C16H22FNO — CID 125448466
(3R)-N-[[1-(3-fluorophenyl)cyclopentyl]methyl]oxolan-3-amine (PubChem CID 125448466) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is (3R)-N-[[1-(3-fluorophenyl)cyclopentyl]methyl]oxolan-3-amine.
| Compound Name | (3R)-N-[[1-(3-fluorophenyl)cyclopentyl]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 125448466 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3R)-N-[[1-(3-fluorophenyl)cyclopentyl]methyl]oxolan-3-amine |
| SMILES | Fc1cccc(C2(CN[C@@H]3CCOC3)CCCC2)c1 |
| InChI | InChI=1S/C16H22FNO/c17-14-5-3-4-13(10-14)16(7-1-2-8-16)12-18-15-6-9-19-11-15/h3-5,10,15,18H,1-2,6-9,11-12H2/t15-/m1/s1 |
| InChIKey | GWYCLZCKSYIXHQ-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |