C10H17N3 — CID 125449054
1,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine (PubChem CID 125449054) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine.
| Compound Name | 1,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine |
|---|---|
| PubChem CID | 125449054 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[4,5-c]azepine |
| SMILES | Cn1ncc2c1CC(C)(C)CNC2 |
| InChI | InChI=1S/C10H17N3/c1-10(2)4-9-8(5-11-7-10)6-12-13(9)3/h6,11H,4-5,7H2,1-3H3 |
| InChIKey | GJSDCRGCOQJFRV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |