C14H20BN3O2S — CID 125449128
2-[1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]-1,3-thiazole (PubChem CID 125449128) has the molecular formula C14H20BN3O2S and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-[1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]-1,3-thiazole.
| Compound Name | 2-[1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 125449128 |
| Molecular Formula | C14H20BN3O2S |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]-1,3-thiazole |
| SMILES | CCn1nc(-c2nccs2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H20BN3O2S/c1-6-18-11(9-10(17-18)12-16-7-8-21-12)15-19-13(2,3)14(4,5)20-15/h7-9H,6H2,1-5H3 |
| InChIKey | CNOODEAUHJTXNF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|