C9H10O5S2 — CID 125449383
2,6-bis(methylsulfonyl)benzaldehyde (PubChem CID 125449383) has the molecular formula C9H10O5S2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2,6-bis(methylsulfonyl)benzaldehyde.
| Compound Name | 2,6-bis(methylsulfonyl)benzaldehyde |
|---|---|
| PubChem CID | 125449383 |
| Molecular Formula | C9H10O5S2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2,6-bis(methylsulfonyl)benzaldehyde |
| SMILES | CS(=O)(=O)c1cccc(S(C)(=O)=O)c1C=O |
| InChI | InChI=1S/C9H10O5S2/c1-15(11,12)8-4-3-5-9(7(8)6-10)16(2,13)14/h3-6H,1-2H3 |
| InChIKey | JFQUIMADUVIXJT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|