About 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole
1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole (PubChem CID 125449442) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole.
Molecular Properties
| Compound Name | 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole |
| PubChem CID | 125449442 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole |
| SMILES | CCC[C@@H]1CNC[C@H]1c1ccnn1C |
| InChI | InChI=1S/C11H19N3/c1-3-4-9-7-12-8-10(9)11-5-6-13-14(11)2/h5-6,9-10,12H,3-4,7-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | BKWNXFNRPOXKSK-NXEZZACHSA-N |
| XLogP | 1.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole?
The IUPAC name of 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole (CID 125449442) is 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole.
What is the SMILES notation for 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole?
The canonical SMILES for 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole is CCC[C@@H]1CNC[C@H]1c1ccnn1C.
What is the InChIKey of 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole?
The InChIKey is BKWNXFNRPOXKSK-NXEZZACHSA-N. The full InChI is InChI=1S/C11H19N3/c1-3-4-9-7-12-8-10(9)11-5-6-13-14(11)2/h5-6,9-10,12H,3-4,7-8H2,1-2H3/t9-,10-/m1/s1.
What are the key properties of 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole?
1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole has a molecular weight of 193.29 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[(3S,4S)-4-propylpyrrolidin-3-yl]pyrazole is sourced from PubChem (CID 125449442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).