About (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one
(3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one (PubChem CID 125449969) has the molecular formula C14H14F3NO2
and a molecular weight of 285.26 g/mol. Its IUPAC name is (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one.
Molecular Properties
| Compound Name | (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one |
| PubChem CID | 125449969 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one |
| SMILES | CCC(=O)[C@@H]1CCCN(c2c(F)cc(F)cc2F)C1=O |
| InChI | InChI=1S/C14H14F3NO2/c1-2-12(19)9-4-3-5-18(14(9)20)13-10(16)6-8(15)7-11(13)17/h6-7,9H,2-5H2,1H3/t9-/m0/s1 |
| InChIKey | JTFODPHLOMIZHO-VIFPVBQESA-N |
| XLogP | 2.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one?
The IUPAC name of (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one (CID 125449969) is (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one.
What is the SMILES notation for (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one?
The canonical SMILES for (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one is CCC(=O)[C@@H]1CCCN(c2c(F)cc(F)cc2F)C1=O.
What is the InChIKey of (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one?
The InChIKey is JTFODPHLOMIZHO-VIFPVBQESA-N. The full InChI is InChI=1S/C14H14F3NO2/c1-2-12(19)9-4-3-5-18(14(9)20)13-10(16)6-8(15)7-11(13)17/h6-7,9H,2-5H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one?
(3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one has a molecular weight of 285.26 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-propanoyl-1-(2,4,6-trifluorophenyl)piperidin-2-one is sourced from PubChem (CID 125449969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).