About 4-cyclohexyl-2,6-difluoroaniline
4-cyclohexyl-2,6-difluoroaniline (PubChem CID 125450024) has the molecular formula C12H15F2N
and a molecular weight of 211.25 g/mol. Its IUPAC name is 4-cyclohexyl-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-cyclohexyl-2,6-difluoroaniline |
| PubChem CID | 125450024 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-cyclohexyl-2,6-difluoroaniline |
| SMILES | Nc1c(F)cc(C2CCCCC2)cc1F |
| InChI | InChI=1S/C12H15F2N/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h6-8H,1-5,15H2 |
| InChIKey | QCJBSULUPFKXKH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-2,6-difluoroaniline?
The IUPAC name of 4-cyclohexyl-2,6-difluoroaniline (CID 125450024) is 4-cyclohexyl-2,6-difluoroaniline.
What is the SMILES notation for 4-cyclohexyl-2,6-difluoroaniline?
The canonical SMILES for 4-cyclohexyl-2,6-difluoroaniline is Nc1c(F)cc(C2CCCCC2)cc1F.
What is the InChIKey of 4-cyclohexyl-2,6-difluoroaniline?
The InChIKey is QCJBSULUPFKXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h6-8H,1-5,15H2.
What are the key properties of 4-cyclohexyl-2,6-difluoroaniline?
4-cyclohexyl-2,6-difluoroaniline has a molecular weight of 211.25 g/mol, XLogP of 3.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-2,6-difluoroaniline is sourced from PubChem (CID 125450024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).