C14H21NO — CID 125450658
2-[(3S)-4,4-diethylpyrrolidin-3-yl]phenol (PubChem CID 125450658) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(3S)-4,4-diethylpyrrolidin-3-yl]phenol.
| Compound Name | 2-[(3S)-4,4-diethylpyrrolidin-3-yl]phenol |
|---|---|
| PubChem CID | 125450658 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-[(3S)-4,4-diethylpyrrolidin-3-yl]phenol |
| SMILES | CCC1(CC)CNC[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C14H21NO/c1-3-14(4-2)10-15-9-12(14)11-7-5-6-8-13(11)16/h5-8,12,15-16H,3-4,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | OOIFJNAQGLOKRB-GFCCVEGCSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |