About 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline
2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline (PubChem CID 125451282) has the molecular formula C10H12FN3O
and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline |
| PubChem CID | 125451282 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline |
| SMILES | Nc1cc(F)ccc1OCC1=NCCN1 |
| InChI | InChI=1S/C10H12FN3O/c11-7-1-2-9(8(12)5-7)15-6-10-13-3-4-14-10/h1-2,5H,3-4,6,12H2,(H,13,14) |
| InChIKey | BKWDLPIRCGACIH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline (CID 125451282) is 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline is Nc1cc(F)ccc1OCC1=NCCN1.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline?
The InChIKey is BKWDLPIRCGACIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN3O/c11-7-1-2-9(8(12)5-7)15-6-10-13-3-4-14-10/h1-2,5H,3-4,6,12H2,(H,13,14).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline?
2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline has a molecular weight of 209.22 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-ylmethoxy)-5-fluoroaniline is sourced from PubChem (CID 125451282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).