About 1,1-difluoropropane
1,1-difluoropropane (PubChem CID 12545136) has the molecular formula C3H6F2
and a molecular weight of 80.08 g/mol. Its IUPAC name is 1,1-difluoropropane.
Molecular Properties
| Compound Name | 1,1-difluoropropane |
| PubChem CID | 12545136 |
| Molecular Formula | C3H6F2 |
| Molecular Weight | 80.08 g/mol |
| Exact Mass | 80.04 |
| IUPAC Name | 1,1-difluoropropane |
| SMILES | CCC(F)F |
| InChI | InChI=1S/C3H6F2/c1-2-3(4)5/h3H,2H2,1H3 |
| InChIKey | CTJAKAQLCQKBTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.08 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoropropane?
The IUPAC name of 1,1-difluoropropane (CID 12545136) is 1,1-difluoropropane.
What is the SMILES notation for 1,1-difluoropropane?
The canonical SMILES for 1,1-difluoropropane is CCC(F)F.
What is the InChIKey of 1,1-difluoropropane?
The InChIKey is CTJAKAQLCQKBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6F2/c1-2-3(4)5/h3H,2H2,1H3.
What are the key properties of 1,1-difluoropropane?
1,1-difluoropropane has a molecular weight of 80.08 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoropropane is sourced from PubChem (CID 12545136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).