About (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine
(3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine (PubChem CID 125451382) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine.
Molecular Properties
| Compound Name | (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine |
| PubChem CID | 125451382 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine |
| SMILES | CC[C@@]1(C)CNc2c(N)cccc21 |
| InChI | InChI=1S/C11H16N2/c1-3-11(2)7-13-10-8(11)5-4-6-9(10)12/h4-6,13H,3,7,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | BNYNNMHFCWDGKP-NSHDSACASA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine?
The IUPAC name of (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine (CID 125451382) is (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine.
What is the SMILES notation for (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine?
The canonical SMILES for (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine is CC[C@@]1(C)CNc2c(N)cccc21.
What is the InChIKey of (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine?
The InChIKey is BNYNNMHFCWDGKP-NSHDSACASA-N. The full InChI is InChI=1S/C11H16N2/c1-3-11(2)7-13-10-8(11)5-4-6-9(10)12/h4-6,13H,3,7,12H2,1-2H3/t11-/m0/s1.
What are the key properties of (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine?
(3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine has a molecular weight of 176.26 g/mol, XLogP of 2.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethyl-3-methyl-1,2-dihydroindol-7-amine is sourced from PubChem (CID 125451382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).