1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid

C9H12N2O4 — CID 125451512

IUPAC1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid
SMILESCC(C)c1c(C(=O)O)c(=O)[nH]c(=O)n1C
InChIInChI=1S/C9H12N2O4/c1-4(2)6-5(8(13)14)7(12)10-9(15)11(6)3/h4H,1-3H3,(H,13,14)(H,10,12,15)
InChIKeyBRLNBDGTMFXIOJ-UHFFFAOYSA-N
MW212.20 g/mol
LogP-0.10
Rot. Bonds2

About 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid

1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid (PubChem CID 125451512) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid
PubChem CID125451512
Molecular FormulaC9H12N2O4
Molecular Weight212.20 g/mol
Exact Mass212.08
IUPAC Name1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid
SMILESCC(C)c1c(C(=O)O)c(=O)[nH]c(=O)n1C
InChIInChI=1S/C9H12N2O4/c1-4(2)6-5(8(13)14)7(12)10-9(15)11(6)3/h4H,1-3H3,(H,13,14)(H,10,12,15)
InChIKeyBRLNBDGTMFXIOJ-UHFFFAOYSA-N
XLogP-0.10
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 5-0.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
The IUPAC name of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid (CID 125451512) is 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
The canonical SMILES for 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid is CC(C)c1c(C(=O)O)c(=O)[nH]c(=O)n1C.
What is the InChIKey of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
The InChIKey is BRLNBDGTMFXIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-4(2)6-5(8(13)14)7(12)10-9(15)11(6)3/h4H,1-3H3,(H,13,14)(H,10,12,15).
What are the key properties of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid has a molecular weight of 212.20 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 125451512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).