About 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid
1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid (PubChem CID 125451512) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid |
| PubChem CID | 125451512 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid |
| SMILES | CC(C)c1c(C(=O)O)c(=O)[nH]c(=O)n1C |
| InChI | InChI=1S/C9H12N2O4/c1-4(2)6-5(8(13)14)7(12)10-9(15)11(6)3/h4H,1-3H3,(H,13,14)(H,10,12,15) |
| InChIKey | BRLNBDGTMFXIOJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
The IUPAC name of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid (CID 125451512) is 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
The canonical SMILES for 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid is CC(C)c1c(C(=O)O)c(=O)[nH]c(=O)n1C.
What is the InChIKey of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
The InChIKey is BRLNBDGTMFXIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-4(2)6-5(8(13)14)7(12)10-9(15)11(6)3/h4H,1-3H3,(H,13,14)(H,10,12,15).
What are the key properties of 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid?
1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid has a molecular weight of 212.20 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,4-dioxo-6-propan-2-ylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 125451512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).