C8H16FN — CID 125452174
(1S,2R,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-amine (PubChem CID 125452174) has the molecular formula C8H16FN and a molecular weight of 145.22 g/mol. Its IUPAC name is (1S,2R,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-amine.
| Compound Name | (1S,2R,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 125452174 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | (1S,2R,3S,6R)-2-fluoro-3,6-dimethylcyclohexan-1-amine |
| SMILES | C[C@@H]1CC[C@H](C)[C@@H](F)[C@H]1N |
| InChI | InChI=1S/C8H16FN/c1-5-3-4-6(2)8(10)7(5)9/h5-8H,3-4,10H2,1-2H3/t5-,6+,7+,8-/m0/s1 |
| InChIKey | WGKWXJJSLHJBEF-OSMVPFSASA-N |
| XLogP | 1.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |