About [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 125452555) has the molecular formula C7H12FNO3S
and a molecular weight of 209.24 g/mol. Its IUPAC name is [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 125452555 |
| Molecular Formula | C7H12FNO3S |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | C[C@H]1CNC(=O)[C@]1(C)CS(=O)(=O)F |
| InChI | InChI=1S/C7H12FNO3S/c1-5-3-9-6(10)7(5,2)4-13(8,11)12/h5H,3-4H2,1-2H3,(H,9,10)/t5-,7+/m0/s1 |
| InChIKey | HQWUPHGGDCFDDG-CAHLUQPWSA-N |
| XLogP | 0.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 125452555) is [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride is C[C@H]1CNC(=O)[C@]1(C)CS(=O)(=O)F.
What is the InChIKey of [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is HQWUPHGGDCFDDG-CAHLUQPWSA-N. The full InChI is InChI=1S/C7H12FNO3S/c1-5-3-9-6(10)7(5,2)4-13(8,11)12/h5H,3-4H2,1-2H3,(H,9,10)/t5-,7+/m0/s1.
What are the key properties of [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 209.24 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-3,4-dimethyl-2-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 125452555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).