C7H13ClO — CID 125452921
(2R,3S,4S,5S)-3-chloro-2,4,5-trimethyloxolane (PubChem CID 125452921) has the molecular formula C7H13ClO and a molecular weight of 148.63 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3-chloro-2,4,5-trimethyloxolane.
| Compound Name | (2R,3S,4S,5S)-3-chloro-2,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 125452921 |
| Molecular Formula | C7H13ClO |
| Molecular Weight | 148.63 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (2R,3S,4S,5S)-3-chloro-2,4,5-trimethyloxolane |
| SMILES | C[C@@H]1[C@H](Cl)[C@@H](C)O[C@H]1C |
| InChI | InChI=1S/C7H13ClO/c1-4-5(2)9-6(3)7(4)8/h4-7H,1-3H3/t4-,5-,6+,7-/m0/s1 |
| InChIKey | IXIMASJNWQSGSC-YTLHQDLWSA-N |
| XLogP | 2.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|