C12H16ClN — CID 125453363
(3R,4S)-3-(2-chlorophenyl)-4-ethylpyrrolidine (PubChem CID 125453363) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (3R,4S)-3-(2-chlorophenyl)-4-ethylpyrrolidine.
| Compound Name | (3R,4S)-3-(2-chlorophenyl)-4-ethylpyrrolidine |
|---|---|
| PubChem CID | 125453363 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (3R,4S)-3-(2-chlorophenyl)-4-ethylpyrrolidine |
| SMILES | CC[C@@H]1CNC[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C12H16ClN/c1-2-9-7-14-8-11(9)10-5-3-4-6-12(10)13/h3-6,9,11,14H,2,7-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | QARAAPBSPOHHLQ-MWLCHTKSSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |