About 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride
2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride (PubChem CID 125453634) has the molecular formula C6H6FNO2S2
and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride.
Molecular Properties
| Compound Name | 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride |
| PubChem CID | 125453634 |
| Molecular Formula | C6H6FNO2S2 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 206.98 |
| IUPAC Name | 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1cnc(C2CC2)s1 |
| InChI | InChI=1S/C6H6FNO2S2/c7-12(9,10)5-3-8-6(11-5)4-1-2-4/h3-4H,1-2H2 |
| InChIKey | MTVHOIACEFCVBI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride?
The IUPAC name of 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride (CID 125453634) is 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride.
What is the SMILES notation for 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride?
The canonical SMILES for 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride is O=S(=O)(F)c1cnc(C2CC2)s1.
What is the InChIKey of 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride?
The InChIKey is MTVHOIACEFCVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO2S2/c7-12(9,10)5-3-8-6(11-5)4-1-2-4/h3-4H,1-2H2.
What are the key properties of 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride?
2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride has a molecular weight of 207.25 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,3-thiazole-5-sulfonyl fluoride is sourced from PubChem (CID 125453634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).