C10H17N3O — CID 125455586
(2S,4R)-2-(azidomethyl)-4-cyclopentyloxolane (PubChem CID 125455586) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (2S,4R)-2-(azidomethyl)-4-cyclopentyloxolane.
| Compound Name | (2S,4R)-2-(azidomethyl)-4-cyclopentyloxolane |
|---|---|
| PubChem CID | 125455586 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (2S,4R)-2-(azidomethyl)-4-cyclopentyloxolane |
| SMILES | [N-]=[N+]=NC[C@@H]1C[C@H](C2CCCC2)CO1 |
| InChI | InChI=1S/C10H17N3O/c11-13-12-6-10-5-9(7-14-10)8-3-1-2-4-8/h8-10H,1-7H2/t9-,10-/m0/s1 |
| InChIKey | DZFQNMLXBZMBRE-UWVGGRQHSA-N |
| XLogP | 2.89 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|