C9H16BrNO — CID 125455630
(2R,3aS,7aR)-3a-(bromomethyl)-2-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 125455630) has the molecular formula C9H16BrNO and a molecular weight of 234.14 g/mol. Its IUPAC name is (2R,3aS,7aR)-3a-(bromomethyl)-2-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (2R,3aS,7aR)-3a-(bromomethyl)-2-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 125455630 |
| Molecular Formula | C9H16BrNO |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (2R,3aS,7aR)-3a-(bromomethyl)-2-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | C[C@@H]1C[C@]2(CBr)CNCC[C@H]2O1 |
| InChI | InChI=1S/C9H16BrNO/c1-7-4-9(5-10)6-11-3-2-8(9)12-7/h7-8,11H,2-6H2,1H3/t7-,8-,9+/m1/s1 |
| InChIKey | CWPFONWTCAKAJV-HLTSFMKQSA-N |
| XLogP | 1.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|