C12H13F3N2O — CID 125456068
(3S,6R)-6-methyl-3-[2-(trifluoromethyl)phenyl]piperazin-2-one (PubChem CID 125456068) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is (3S,6R)-6-methyl-3-[2-(trifluoromethyl)phenyl]piperazin-2-one.
| Compound Name | (3S,6R)-6-methyl-3-[2-(trifluoromethyl)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 125456068 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (3S,6R)-6-methyl-3-[2-(trifluoromethyl)phenyl]piperazin-2-one |
| SMILES | C[C@@H]1CN[C@@H](c2ccccc2C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C12H13F3N2O/c1-7-6-16-10(11(18)17-7)8-4-2-3-5-9(8)12(13,14)15/h2-5,7,10,16H,6H2,1H3,(H,17,18)/t7-,10+/m1/s1 |
| InChIKey | DXEXLVYEQYRYIU-XCBNKYQSSA-N |
| XLogP | 1.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |