C6H8F3N3O — CID 125456426
(2S,4R)-2-(azidomethyl)-4-(trifluoromethyl)oxolane (PubChem CID 125456426) has the molecular formula C6H8F3N3O and a molecular weight of 195.14 g/mol. Its IUPAC name is (2S,4R)-2-(azidomethyl)-4-(trifluoromethyl)oxolane.
| Compound Name | (2S,4R)-2-(azidomethyl)-4-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 125456426 |
| Molecular Formula | C6H8F3N3O |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (2S,4R)-2-(azidomethyl)-4-(trifluoromethyl)oxolane |
| SMILES | [N-]=[N+]=NC[C@@H]1C[C@@H](C(F)(F)F)CO1 |
| InChI | InChI=1S/C6H8F3N3O/c7-6(8,9)4-1-5(13-3-4)2-11-12-10/h4-5H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | MMMLYEQPIMKRTM-UHNVWZDZSA-N |
| XLogP | 2.26 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|