C12H18N2O — CID 125458325
5-[(1R,3R,5S,6S)-3,5-dimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-1-methylpyrazole (PubChem CID 125458325) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 5-[(1R,3R,5S,6S)-3,5-dimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-1-methylpyrazole.
| Compound Name | 5-[(1R,3R,5S,6S)-3,5-dimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-1-methylpyrazole |
|---|---|
| PubChem CID | 125458325 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 5-[(1R,3R,5S,6S)-3,5-dimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-1-methylpyrazole |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]2O[C@@]2(c2ccnn2C)C1 |
| InChI | InChI=1S/C12H18N2O/c1-8-6-9(2)11-12(7-8,15-11)10-4-5-13-14(10)3/h4-5,8-9,11H,6-7H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | RNMHVGCSZYDRSP-LLHIFLOGSA-N |
| XLogP | 2.08 |
| TPSA | 30.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|