C12H22O2 — CID 125458736
[(3aS,5R,7aR)-5-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl]methanol (PubChem CID 125458736) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is [(3aS,5R,7aR)-5-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl]methanol.
| Compound Name | [(3aS,5R,7aR)-5-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl]methanol |
|---|---|
| PubChem CID | 125458736 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [(3aS,5R,7aR)-5-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl]methanol |
| SMILES | CC(C)[C@@H]1CC[C@H]2OCC[C@]2(CO)C1 |
| InChI | InChI=1S/C12H22O2/c1-9(2)10-3-4-11-12(7-10,8-13)5-6-14-11/h9-11,13H,3-8H2,1-2H3/t10-,11-,12-/m1/s1 |
| InChIKey | WGHVAZBDUCMOAD-IJLUTSLNSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |