C8H7F3N2O2S — CID 125458802
2,2,2-trifluoro-N-[2-(2-formyl-1,3-thiazol-4-yl)ethyl]acetamide (PubChem CID 125458802) has the molecular formula C8H7F3N2O2S and a molecular weight of 252.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2-formyl-1,3-thiazol-4-yl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(2-formyl-1,3-thiazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 125458802 |
| Molecular Formula | C8H7F3N2O2S |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2-formyl-1,3-thiazol-4-yl)ethyl]acetamide |
| SMILES | O=Cc1nc(CCNC(=O)C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H7F3N2O2S/c9-8(10,11)7(15)12-2-1-5-4-16-6(3-14)13-5/h3-4H,1-2H2,(H,12,15) |
| InChIKey | ZAGBYWXWLNHNMA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|