About 3-chloro-4-fluorohexane
3-chloro-4-fluorohexane (PubChem CID 12545925) has the molecular formula C6H12ClF
and a molecular weight of 138.61 g/mol. Its IUPAC name is 3-chloro-4-fluorohexane.
Molecular Properties
| Compound Name | 3-chloro-4-fluorohexane |
| PubChem CID | 12545925 |
| Molecular Formula | C6H12ClF |
| Molecular Weight | 138.61 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 3-chloro-4-fluorohexane |
| SMILES | CCC(F)C(Cl)CC |
| InChI | InChI=1S/C6H12ClF/c1-3-5(7)6(8)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | UPXFAIJEAILWFH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-fluorohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-fluorohexane?
The IUPAC name of 3-chloro-4-fluorohexane (CID 12545925) is 3-chloro-4-fluorohexane.
What is the SMILES notation for 3-chloro-4-fluorohexane?
The canonical SMILES for 3-chloro-4-fluorohexane is CCC(F)C(Cl)CC.
What is the InChIKey of 3-chloro-4-fluorohexane?
The InChIKey is UPXFAIJEAILWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClF/c1-3-5(7)6(8)4-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-chloro-4-fluorohexane?
3-chloro-4-fluorohexane has a molecular weight of 138.61 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-fluorohexane is sourced from PubChem (CID 12545925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).