C14H20N2O4 — CID 125461582
diethyl 1-cyclopentylpyrazole-3,5-dicarboxylate (PubChem CID 125461582) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is diethyl 1-cyclopentylpyrazole-3,5-dicarboxylate.
| Compound Name | diethyl 1-cyclopentylpyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 125461582 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | diethyl 1-cyclopentylpyrazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)n(C2CCCC2)n1 |
| InChI | InChI=1S/C14H20N2O4/c1-3-19-13(17)11-9-12(14(18)20-4-2)16(15-11)10-7-5-6-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | NOLYVYIOQLXLBU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |