C13H20O4 — CID 125462066
(3aR,7aS)-5-(1,1-dimethoxyethyl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole (PubChem CID 125462066) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3aR,7aS)-5-(1,1-dimethoxyethyl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole.
| Compound Name | (3aR,7aS)-5-(1,1-dimethoxyethyl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 125462066 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3aR,7aS)-5-(1,1-dimethoxyethyl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
| SMILES | COC(C)(OC)C1=C[C@H]2OC(C)(C)O[C@H]2C=C1 |
| InChI | InChI=1S/C13H20O4/c1-12(2)16-10-7-6-9(8-11(10)17-12)13(3,14-4)15-5/h6-8,10-11H,1-5H3/t10-,11+/m0/s1 |
| InChIKey | OSGHCQROFPEOLV-WDEREUQCSA-N |
| XLogP | 2.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|