About 7,12-dihexyloctadecane-7,12-diol
7,12-dihexyloctadecane-7,12-diol (PubChem CID 12546207) has the molecular formula C30H62O2
and a molecular weight of 454.82 g/mol. Its IUPAC name is 7,12-dihexyloctadecane-7,12-diol.
Molecular Properties
| Compound Name | 7,12-dihexyloctadecane-7,12-diol |
| PubChem CID | 12546207 |
| Molecular Formula | C30H62O2 |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 454.47 |
| IUPAC Name | 7,12-dihexyloctadecane-7,12-diol |
| SMILES | CCCCCCC(O)(CCCCCC)CCCCC(O)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C30H62O2/c1-5-9-13-17-23-29(31,24-18-14-10-6-2)27-21-22-28-30(32,25-19-15-11-7-3)26-20-16-12-8-4/h31-32H,5-28H2,1-4H3 |
| InChIKey | PUZZNDFCNXDISG-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7,12-dihexyloctadecane-7,12-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,12-dihexyloctadecane-7,12-diol?
The IUPAC name of 7,12-dihexyloctadecane-7,12-diol (CID 12546207) is 7,12-dihexyloctadecane-7,12-diol.
What is the SMILES notation for 7,12-dihexyloctadecane-7,12-diol?
The canonical SMILES for 7,12-dihexyloctadecane-7,12-diol is CCCCCCC(O)(CCCCCC)CCCCC(O)(CCCCCC)CCCCCC.
What is the InChIKey of 7,12-dihexyloctadecane-7,12-diol?
The InChIKey is PUZZNDFCNXDISG-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H62O2/c1-5-9-13-17-23-29(31,24-18-14-10-6-2)27-21-22-28-30(32,25-19-15-11-7-3)26-20-16-12-8-4/h31-32H,5-28H2,1-4H3.
What are the key properties of 7,12-dihexyloctadecane-7,12-diol?
7,12-dihexyloctadecane-7,12-diol has a molecular weight of 454.82 g/mol, XLogP of 9.89, 25 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,12-dihexyloctadecane-7,12-diol is sourced from PubChem (CID 12546207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).