C17H13Cl2NO2 — CID 125462107
4-[3-(2,6-dichloro-4-pyridinyl)-1-bicyclo[1.1.1]pentanyl]benzoic acid (PubChem CID 125462107) has the molecular formula C17H13Cl2NO2 and a molecular weight of 334.20 g/mol. Its IUPAC name is 4-[3-(2,6-dichloro-4-pyridinyl)-1-bicyclo[1.1.1]pentanyl]benzoic acid.
| Compound Name | 4-[3-(2,6-dichloro-4-pyridinyl)-1-bicyclo[1.1.1]pentanyl]benzoic acid |
|---|---|
| PubChem CID | 125462107 |
| Molecular Formula | C17H13Cl2NO2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 4-[3-(2,6-dichloro-4-pyridinyl)-1-bicyclo[1.1.1]pentanyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C23CC(c4cc(Cl)nc(Cl)c4)(C2)C3)cc1 |
| InChI | InChI=1S/C17H13Cl2NO2/c18-13-5-12(6-14(19)20-13)17-7-16(8-17,9-17)11-3-1-10(2-4-11)15(21)22/h1-6H,7-9H2,(H,21,22) |
| InChIKey | XPXVRNMOIALSIP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|