C25H37N3O3 — CID 125462293
oxan-4-yl-[(4R)-4-(4-phenylpiperazin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone (PubChem CID 125462293) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is oxan-4-yl-[(4R)-4-(4-phenylpiperazin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone.
| Compound Name | oxan-4-yl-[(4R)-4-(4-phenylpiperazin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 125462293 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | oxan-4-yl-[(4R)-4-(4-phenylpiperazin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CCC2(CC1)C[C@H](N1CCN(c3ccccc3)CC1)CCO2 |
| InChI | InChI=1S/C25H37N3O3/c29-24(21-6-17-30-18-7-21)28-11-9-25(10-12-28)20-23(8-19-31-25)27-15-13-26(14-16-27)22-4-2-1-3-5-22/h1-5,21,23H,6-20H2/t23-/m1/s1 |
| InChIKey | LORBMVAGJHDTIN-HSZRJFAPSA-N |
| XLogP | 2.78 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |