C20H30O6S — CID 125462727
(Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-[[(3S)-2,3-dihydrothiophen-3-yl]oxy]-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 125462727) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-[[(3S)-2,3-dihydrothiophen-3-yl]oxy]-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-[[(3S)-2,3-dihydrothiophen-3-yl]oxy]-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 125462727 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3S)-4-[[(3S)-2,3-dihydrothiophen-3-yl]oxy]-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](O)CO[C@H]2C=CSC2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C20H30O6S/c21-14(12-26-15-9-10-27-13-15)7-8-17-16(18(22)11-19(17)23)5-3-1-2-4-6-20(24)25/h1,3,7-10,14-19,21-23H,2,4-6,11-13H2,(H,24,25)/b3-1-,8-7+/t14-,15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | YABYQSOYCHRWMY-SEXSZFCHSA-N |
| XLogP | 2.11 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|