C14H19NO3 — CID 125462794
N-[(3-hydroxyphenyl)methyl]-N-methyl-2-[(3R)-oxolan-3-yl]acetamide (PubChem CID 125462794) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[(3-hydroxyphenyl)methyl]-N-methyl-2-[(3R)-oxolan-3-yl]acetamide.
| Compound Name | N-[(3-hydroxyphenyl)methyl]-N-methyl-2-[(3R)-oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 125462794 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[(3-hydroxyphenyl)methyl]-N-methyl-2-[(3R)-oxolan-3-yl]acetamide |
| SMILES | CN(Cc1cccc(O)c1)C(=O)C[C@H]1CCOC1 |
| InChI | InChI=1S/C14H19NO3/c1-15(9-11-3-2-4-13(16)7-11)14(17)8-12-5-6-18-10-12/h2-4,7,12,16H,5-6,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | LEDJLUGZQBQJTJ-GFCCVEGCSA-N |
| XLogP | 1.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |