C22H26N2O6 — CID 125462967
(2S)-3-[bis[(1S)-1-hydroxyethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 125462967) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is (2S)-3-[bis[(1S)-1-hydroxyethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[bis[(1S)-1-hydroxyethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 125462967 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2S)-3-[bis[(1S)-1-hydroxyethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | C[C@H](O)N(C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)[C@H](C)O |
| InChI | InChI=1S/C22H26N2O6/c1-13(25)24(14(2)26)11-20(21(27)28)23-22(29)30-12-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,13-14,19-20,25-26H,11-12H2,1-2H3,(H,23,29)(H,27,28)/t13-,14-,20-/m0/s1 |
| InChIKey | MCKUIPXDWQKPDP-YRVVQQKDSA-N |
| XLogP | 1.96 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|