About (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol
(2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol (PubChem CID 125463691) has the molecular formula C19H13BrF6O
and a molecular weight of 451.20 g/mol. Its IUPAC name is (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol |
| PubChem CID | 125463691 |
| Molecular Formula | C19H13BrF6O |
| Molecular Weight | 451.20 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol |
| SMILES | O[C@H](CBr)Cc1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C19H13BrF6O/c20-9-14(27)6-11-5-10-1-2-12(18(21,22)23)7-16(10)17-8-13(19(24,25)26)3-4-15(11)17/h1-5,7-8,14,27H,6,9H2/t14-/m0/s1 |
| InChIKey | NKNBVMQFASPLCD-AWEZNQCLSA-N |
| XLogP | 6.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.20 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol?
The IUPAC name of (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol (CID 125463691) is (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol.
What is the SMILES notation for (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol?
The canonical SMILES for (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol is O[C@H](CBr)Cc1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12.
What is the InChIKey of (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol?
The InChIKey is NKNBVMQFASPLCD-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H13BrF6O/c20-9-14(27)6-11-5-10-1-2-12(18(21,22)23)7-16(10)17-8-13(19(24,25)26)3-4-15(11)17/h1-5,7-8,14,27H,6,9H2/t14-/m0/s1.
What are the key properties of (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol?
(2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol has a molecular weight of 451.20 g/mol, XLogP of 6.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-bromopropan-2-ol is sourced from PubChem (CID 125463691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).