About [(1E)-buta-1,3-dienyl]carbamic acid
[(1E)-buta-1,3-dienyl]carbamic acid (PubChem CID 12546496) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienyl]carbamic acid.
Molecular Properties
| Compound Name | [(1E)-buta-1,3-dienyl]carbamic acid |
| PubChem CID | 12546496 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | [(1E)-buta-1,3-dienyl]carbamic acid |
| SMILES | C=C/C=C/NC(=O)O |
| InChI | InChI=1S/C5H7NO2/c1-2-3-4-6-5(7)8/h2-4,6H,1H2,(H,7,8)/b4-3+ |
| InChIKey | XUHZSKZXOIAYSU-ONEGZZNKSA-N |
| XLogP | 0.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-buta-1,3-dienyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-buta-1,3-dienyl]carbamic acid?
The IUPAC name of [(1E)-buta-1,3-dienyl]carbamic acid (CID 12546496) is [(1E)-buta-1,3-dienyl]carbamic acid.
What is the SMILES notation for [(1E)-buta-1,3-dienyl]carbamic acid?
The canonical SMILES for [(1E)-buta-1,3-dienyl]carbamic acid is C=C/C=C/NC(=O)O.
What is the InChIKey of [(1E)-buta-1,3-dienyl]carbamic acid?
The InChIKey is XUHZSKZXOIAYSU-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H7NO2/c1-2-3-4-6-5(7)8/h2-4,6H,1H2,(H,7,8)/b4-3+.
What are the key properties of [(1E)-buta-1,3-dienyl]carbamic acid?
[(1E)-buta-1,3-dienyl]carbamic acid has a molecular weight of 113.12 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-buta-1,3-dienyl]carbamic acid is sourced from PubChem (CID 12546496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).